Structre Search
more >>Hot Product
Contact us
Email:
michaelhsiung@arkpharmtech.com
po@arkpharmtech.com
Product Search
Pyridin-4-ylboronic acid
|
| Product Name | Pyridin-4-ylboronic acid |
| Synonyms | 4-PYRIDINEBORONIC ACID; 4-PYRIDINYLBORONIC ACID; 4-PYRIDYLBORONIC ACID; AKOS BRN-0273; BUTTPARK 43\57-08; CHEMBRDG-BB 3200984; PYRIDIN-4-YL-4-BORONIC ACID; PYRIDIN-4-YLBORONIC ACID; PYRIDINE-4-BORONIC ACID; PYRIDINE-4-BORONIC ACID HYDRATE; PYRIDYL-4-BORONIC ACID; RARECHEM AH PB 0240; TIMTEC-BB SBB004280; PYRIDINE-4-BORONIC ACID HYDRATE: CA 10-15% WATER; 4-Pyridylboronic Acid (contains varying amounts of Anhydride); (Pyridin-4-yl)boronic acid (may contain varying amounts of anhydride); B-4-Pyridinylboronic Acid; Pyridine-4-boronic acid ,98% |
| Catalog No. | H-018886 |
| CAS No. | 1692-15-5 |
| Molecular Formula | C5H6BNO2 |
| Molecular Weight | 122.91764 |
| Smile Code | C1=C(C=CN=C1)B(O)O |
| InChI | InChI=1S/C5H6BNO2/c8-6(9)5-1-3-7-4-2-5/h1-4,8-9H |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |
